C7H4I2O3 — CID 12065
4-hydroxy-3,5-diiodobenzoic acid (PubChem CID 12065) has the molecular formula C7H4I2O3 and a molecular weight of 389.91 g/mol. Its IUPAC name is 4-hydroxy-3,5-diiodobenzoic acid.
| Compound Name | 4-hydroxy-3,5-diiodobenzoic acid |
|---|---|
| PubChem CID | 12065 |
| Molecular Formula | C7H4I2O3 |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.82 |
| IUPAC Name | 4-hydroxy-3,5-diiodobenzoic acid |
| SMILES | O=C(O)c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C7H4I2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) |
| InChIKey | XREKTVACBXQCSB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|