C7H6O5 — CID 370
3,4,5-trihydroxybenzoic acid (PubChem CID 370) has the molecular formula C7H6O5 and a molecular weight of 170.12 g/mol. Its IUPAC name is 3,4,5-trihydroxybenzoic acid.
| Compound Name | 3,4,5-trihydroxybenzoic acid |
|---|---|
| PubChem CID | 370 |
| Molecular Formula | C7H6O5 |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 3,4,5-trihydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C7H6O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,8-10H,(H,11,12) |
| InChIKey | LNTHITQWFMADLM-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.12 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|