silver;3,4,5-trihydroxybenzoic acid

C7H6AgO5 — CID 87285421

IUPACsilver;3,4,5-trihydroxybenzoic acid
SMILESO=C(O)c1cc(O)c(O)c(O)c1.[Ag]
InChIInChI=1S/C7H6O5.Ag/c8-4-1-3(7(11)12)2-5(9)6(4)10;/h1-2,8-10H,(H,11,12);
InChIKeySXUIULHXWXAIEQ-UHFFFAOYSA-N
MW277.99 g/mol
LogP0.50
Rot. Bonds1

About silver;3,4,5-trihydroxybenzoic acid

silver;3,4,5-trihydroxybenzoic acid (PubChem CID 87285421) has the molecular formula C7H6AgO5 and a molecular weight of 277.99 g/mol. Its IUPAC name is silver;3,4,5-trihydroxybenzoic acid.

Molecular Properties

Compound Namesilver;3,4,5-trihydroxybenzoic acid
PubChem CID87285421
Molecular FormulaC7H6AgO5
Molecular Weight277.99 g/mol
Exact Mass276.93
IUPAC Namesilver;3,4,5-trihydroxybenzoic acid
SMILESO=C(O)c1cc(O)c(O)c(O)c1.[Ag]
InChIInChI=1S/C7H6O5.Ag/c8-4-1-3(7(11)12)2-5(9)6(4)10;/h1-2,8-10H,(H,11,12);
InChIKeySXUIULHXWXAIEQ-UHFFFAOYSA-N
XLogP0.50
TPSA97.99 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.99
LogP ≤ 50.50
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}

Analyze silver;3,4,5-trihydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of silver;3,4,5-trihydroxybenzoic acid?
The IUPAC name of silver;3,4,5-trihydroxybenzoic acid (CID 87285421) is silver;3,4,5-trihydroxybenzoic acid.
What is the SMILES notation for silver;3,4,5-trihydroxybenzoic acid?
The canonical SMILES for silver;3,4,5-trihydroxybenzoic acid is O=C(O)c1cc(O)c(O)c(O)c1.[Ag].
What is the InChIKey of silver;3,4,5-trihydroxybenzoic acid?
The InChIKey is SXUIULHXWXAIEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O5.Ag/c8-4-1-3(7(11)12)2-5(9)6(4)10;/h1-2,8-10H,(H,11,12);.
What are the key properties of silver;3,4,5-trihydroxybenzoic acid?
silver;3,4,5-trihydroxybenzoic acid has a molecular weight of 277.99 g/mol, XLogP of 0.50, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for silver;3,4,5-trihydroxybenzoic acid is sourced from PubChem (CID 87285421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).