C7H9BiCuO5 — CID 175210163
bismuthane;copper;3,4,5-trihydroxybenzoic acid (PubChem CID 175210163) has the molecular formula C7H9BiCuO5 and a molecular weight of 445.67 g/mol. Its IUPAC name is bismuthane;copper;3,4,5-trihydroxybenzoic acid.
| Compound Name | bismuthane;copper;3,4,5-trihydroxybenzoic acid |
|---|---|
| PubChem CID | 175210163 |
| Molecular Formula | C7H9BiCuO5 |
| Molecular Weight | 445.67 g/mol |
| Exact Mass | 444.95 |
| IUPAC Name | bismuthane;copper;3,4,5-trihydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)c(O)c(O)c1.[BiH3].[Cu] |
| InChI | InChI=1S/C7H6O5.Bi.Cu.3H/c8-4-1-3(7(11)12)2-5(9)6(4)10;;;;;/h1-2,8-10H,(H,11,12);;;;; |
| InChIKey | OTYCSSVTLSWYFW-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.67 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|