4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid

C14H9I2NO4 — CID 3027490

IUPAC4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid
SMILESO=C(O)c1ccc(NC(=O)c2cc(I)c(O)c(I)c2)cc1
InChIInChI=1S/C14H9I2NO4/c15-10-5-8(6-11(16)12(10)18)13(19)17-9-3-1-7(2-4-9)14(20)21/h1-6,18H,(H,17,19)(H,20,21)
InChIKeyCWGMDUCXETVCOH-UHFFFAOYSA-N
MW509.04 g/mol
LogP3.55
Rot. Bonds3

About 4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid

4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid (PubChem CID 3027490) has the molecular formula C14H9I2NO4 and a molecular weight of 509.04 g/mol. Its IUPAC name is 4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid.

Molecular Properties

Compound Name4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid
PubChem CID3027490
Molecular FormulaC14H9I2NO4
Molecular Weight509.04 g/mol
Exact Mass508.86
IUPAC Name4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid
SMILESO=C(O)c1ccc(NC(=O)c2cc(I)c(O)c(I)c2)cc1
InChIInChI=1S/C14H9I2NO4/c15-10-5-8(6-11(16)12(10)18)13(19)17-9-3-1-7(2-4-9)14(20)21/h1-6,18H,(H,17,19)(H,20,21)
InChIKeyCWGMDUCXETVCOH-UHFFFAOYSA-N
XLogP3.55
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500509.04
LogP ≤ 53.55
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid?
The IUPAC name of 4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid (CID 3027490) is 4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid.
What is the SMILES notation for 4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid?
The canonical SMILES for 4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid is O=C(O)c1ccc(NC(=O)c2cc(I)c(O)c(I)c2)cc1.
What is the InChIKey of 4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid?
The InChIKey is CWGMDUCXETVCOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9I2NO4/c15-10-5-8(6-11(16)12(10)18)13(19)17-9-3-1-7(2-4-9)14(20)21/h1-6,18H,(H,17,19)(H,20,21).
What are the key properties of 4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid?
4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid has a molecular weight of 509.04 g/mol, XLogP of 3.55, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-hydroxy-3,5-diiodobenzoyl)amino]benzoic acid is sourced from PubChem (CID 3027490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).