C27H18I3N3O3 — CID 102258249
1-N,3-N,5-N-tris(4-iodophenyl)benzene-1,3,5-tricarboxamide (PubChem CID 102258249) has the molecular formula C27H18I3N3O3 and a molecular weight of 813.17 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(4-iodophenyl)benzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris(4-iodophenyl)benzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 102258249 |
| Molecular Formula | C27H18I3N3O3 |
| Molecular Weight | 813.17 g/mol |
| Exact Mass | 812.85 |
| IUPAC Name | 1-N,3-N,5-N-tris(4-iodophenyl)benzene-1,3,5-tricarboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)c1cc(C(=O)Nc2ccc(I)cc2)cc(C(=O)Nc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C27H18I3N3O3/c28-19-1-7-22(8-2-19)31-25(34)16-13-17(26(35)32-23-9-3-20(29)4-10-23)15-18(14-16)27(36)33-24-11-5-21(30)6-12-24/h1-15H,(H,31,34)(H,32,35)(H,33,36) |
| InChIKey | VEKJBKQUUAGCME-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.17 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|