C13H9Cl2IN2O — CID 82833125
4-amino-3,5-dichloro-N-(4-iodophenyl)benzamide (PubChem CID 82833125) has the molecular formula C13H9Cl2IN2O and a molecular weight of 407.04 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-(4-iodophenyl)benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-(4-iodophenyl)benzamide |
|---|---|
| PubChem CID | 82833125 |
| Molecular Formula | C13H9Cl2IN2O |
| Molecular Weight | 407.04 g/mol |
| Exact Mass | 405.91 |
| IUPAC Name | 4-amino-3,5-dichloro-N-(4-iodophenyl)benzamide |
| SMILES | Nc1c(Cl)cc(C(=O)Nc2ccc(I)cc2)cc1Cl |
| InChI | InChI=1S/C13H9Cl2IN2O/c14-10-5-7(6-11(15)12(10)17)13(19)18-9-3-1-8(16)2-4-9/h1-6H,17H2,(H,18,19) |
| InChIKey | BVSIAZJPLYPPEE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.04 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|