C20H14I2N2O3 — CID 86118799
4-hydroxy-1-N,3-N-bis(4-iodophenyl)benzene-1,3-dicarboxamide (PubChem CID 86118799) has the molecular formula C20H14I2N2O3 and a molecular weight of 584.15 g/mol. Its IUPAC name is 4-hydroxy-1-N,3-N-bis(4-iodophenyl)benzene-1,3-dicarboxamide.
| Compound Name | 4-hydroxy-1-N,3-N-bis(4-iodophenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 86118799 |
| Molecular Formula | C20H14I2N2O3 |
| Molecular Weight | 584.15 g/mol |
| Exact Mass | 583.91 |
| IUPAC Name | 4-hydroxy-1-N,3-N-bis(4-iodophenyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)c1ccc(O)c(C(=O)Nc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C20H14I2N2O3/c21-13-2-6-15(7-3-13)23-19(26)12-1-10-18(25)17(11-12)20(27)24-16-8-4-14(22)5-9-16/h1-11,25H,(H,23,26)(H,24,27) |
| InChIKey | JJAXJOMCKYMZMX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.15 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|