C13H6F4INO — CID 3448469
2,3,4,5-tetrafluoro-N-(4-iodophenyl)benzamide (PubChem CID 3448469) has the molecular formula C13H6F4INO and a molecular weight of 395.09 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-(4-iodophenyl)benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-(4-iodophenyl)benzamide |
|---|---|
| PubChem CID | 3448469 |
| Molecular Formula | C13H6F4INO |
| Molecular Weight | 395.09 g/mol |
| Exact Mass | 394.94 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-(4-iodophenyl)benzamide |
| SMILES | O=C(Nc1ccc(I)cc1)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H6F4INO/c14-9-5-8(10(15)12(17)11(9)16)13(20)19-7-3-1-6(18)2-4-7/h1-5H,(H,19,20) |
| InChIKey | IYNXQAUOHCLRKL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.09 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|