C24H10F8N2O2 — CID 3686160
2,3,4,5-tetrafluoro-N-[3-[(2,3,4,5-tetrafluorobenzoyl)amino]naphthalen-2-yl]benzamide (PubChem CID 3686160) has the molecular formula C24H10F8N2O2 and a molecular weight of 510.34 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-[3-[(2,3,4,5-tetrafluorobenzoyl)amino]naphthalen-2-yl]benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-[3-[(2,3,4,5-tetrafluorobenzoyl)amino]naphthalen-2-yl]benzamide |
|---|---|
| PubChem CID | 3686160 |
| Molecular Formula | C24H10F8N2O2 |
| Molecular Weight | 510.34 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-[3-[(2,3,4,5-tetrafluorobenzoyl)amino]naphthalen-2-yl]benzamide |
| SMILES | O=C(Nc1cc2ccccc2cc1NC(=O)c1cc(F)c(F)c(F)c1F)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H10F8N2O2/c25-13-7-11(17(27)21(31)19(13)29)23(35)33-15-5-9-3-1-2-4-10(9)6-16(15)34-24(36)12-8-14(26)20(30)22(32)18(12)28/h1-8H,(H,33,35)(H,34,36) |
| InChIKey | VWPDHDSPGNNQGT-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.34 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|