C25H17F4N3O — CID 170144431
N-[4-(4-anilinoanilino)phenyl]-2,3,4,5-tetrafluorobenzamide (PubChem CID 170144431) has the molecular formula C25H17F4N3O and a molecular weight of 451.42 g/mol. Its IUPAC name is N-[4-(4-anilinoanilino)phenyl]-2,3,4,5-tetrafluorobenzamide.
| Compound Name | N-[4-(4-anilinoanilino)phenyl]-2,3,4,5-tetrafluorobenzamide |
|---|---|
| PubChem CID | 170144431 |
| Molecular Formula | C25H17F4N3O |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | N-[4-(4-anilinoanilino)phenyl]-2,3,4,5-tetrafluorobenzamide |
| SMILES | O=C(Nc1ccc(Nc2ccc(Nc3ccccc3)cc2)cc1)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H17F4N3O/c26-21-14-20(22(27)24(29)23(21)28)25(33)32-19-12-10-18(11-13-19)31-17-8-6-16(7-9-17)30-15-4-2-1-3-5-15/h1-14,30-31H,(H,32,33) |
| InChIKey | WOXJBHGDNAUUCU-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|