C19H10F4N2O4 — CID 88891604
2,3,4,5-tetrafluoro-N-[4-(4-nitrophenoxy)phenyl]benzamide (PubChem CID 88891604) has the molecular formula C19H10F4N2O4 and a molecular weight of 406.29 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-[4-(4-nitrophenoxy)phenyl]benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-[4-(4-nitrophenoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 88891604 |
| Molecular Formula | C19H10F4N2O4 |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-[4-(4-nitrophenoxy)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H10F4N2O4/c20-15-9-14(16(21)18(23)17(15)22)19(26)24-10-1-5-12(6-2-10)29-13-7-3-11(4-8-13)25(27)28/h1-9H,(H,24,26) |
| InChIKey | WUSVJWFWWWIIFG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|