C21H15F4NO4 — CID 18272971
2,3,4,5-tetrafluoro-N-[4-methoxy-3-(4-methoxyphenoxy)phenyl]benzamide (PubChem CID 18272971) has the molecular formula C21H15F4NO4 and a molecular weight of 421.35 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-[4-methoxy-3-(4-methoxyphenoxy)phenyl]benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-[4-methoxy-3-(4-methoxyphenoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 18272971 |
| Molecular Formula | C21H15F4NO4 |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-[4-methoxy-3-(4-methoxyphenoxy)phenyl]benzamide |
| SMILES | COc1ccc(Oc2cc(NC(=O)c3cc(F)c(F)c(F)c3F)ccc2OC)cc1 |
| InChI | InChI=1S/C21H15F4NO4/c1-28-12-4-6-13(7-5-12)30-17-9-11(3-8-16(17)29-2)26-21(27)14-10-15(22)19(24)20(25)18(14)23/h3-10H,1-2H3,(H,26,27) |
| InChIKey | NGYUWFQRBMEGTF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|