C25H26N2O6 — CID 30257849
2-[2-(dimethylamino)-2-oxoethoxy]-N-[4-methoxy-3-(4-methoxyphenoxy)phenyl]benzamide (PubChem CID 30257849) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-2-oxoethoxy]-N-[4-methoxy-3-(4-methoxyphenoxy)phenyl]benzamide.
| Compound Name | 2-[2-(dimethylamino)-2-oxoethoxy]-N-[4-methoxy-3-(4-methoxyphenoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 30257849 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-[2-(dimethylamino)-2-oxoethoxy]-N-[4-methoxy-3-(4-methoxyphenoxy)phenyl]benzamide |
| SMILES | COc1ccc(Oc2cc(NC(=O)c3ccccc3OCC(=O)N(C)C)ccc2OC)cc1 |
| InChI | InChI=1S/C25H26N2O6/c1-27(2)24(28)16-32-21-8-6-5-7-20(21)25(29)26-17-9-14-22(31-4)23(15-17)33-19-12-10-18(30-3)11-13-19/h5-15H,16H2,1-4H3,(H,26,29) |
| InChIKey | FCMYKUXTBGFRAS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |