C22H20N2O5 — CID 24660239
2-(2-amino-2-oxoethoxy)-N-[4-(2-methoxyphenoxy)phenyl]benzamide (PubChem CID 24660239) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethoxy)-N-[4-(2-methoxyphenoxy)phenyl]benzamide.
| Compound Name | 2-(2-amino-2-oxoethoxy)-N-[4-(2-methoxyphenoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 24660239 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-(2-amino-2-oxoethoxy)-N-[4-(2-methoxyphenoxy)phenyl]benzamide |
| SMILES | COc1ccccc1Oc1ccc(NC(=O)c2ccccc2OCC(N)=O)cc1 |
| InChI | InChI=1S/C22H20N2O5/c1-27-19-8-4-5-9-20(19)29-16-12-10-15(11-13-16)24-22(26)17-6-2-3-7-18(17)28-14-21(23)25/h2-13H,14H2,1H3,(H2,23,25)(H,24,26) |
| InChIKey | JKARBTJCZVCXRI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |