C22H21N3O4 — CID 55843901
N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-2-anilinobenzamide (PubChem CID 55843901) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-2-anilinobenzamide.
| Compound Name | N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-2-anilinobenzamide |
|---|---|
| PubChem CID | 55843901 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-2-anilinobenzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2Nc2ccccc2)cc1OCC(N)=O |
| InChI | InChI=1S/C22H21N3O4/c1-28-19-12-11-16(13-20(19)29-14-21(23)26)25-22(27)17-9-5-6-10-18(17)24-15-7-3-2-4-8-15/h2-13,24H,14H2,1H3,(H2,23,26)(H,25,27) |
| InChIKey | YGVBEDUUWXUSSD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |