C24H23N3O6 — CID 24524390
2-(2-amino-2-oxoethoxy)-N-(4-benzamido-2,5-dimethoxyphenyl)benzamide (PubChem CID 24524390) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethoxy)-N-(4-benzamido-2,5-dimethoxyphenyl)benzamide.
| Compound Name | 2-(2-amino-2-oxoethoxy)-N-(4-benzamido-2,5-dimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 24524390 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 2-(2-amino-2-oxoethoxy)-N-(4-benzamido-2,5-dimethoxyphenyl)benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2OCC(N)=O)c(OC)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O6/c1-31-20-13-18(27-24(30)16-10-6-7-11-19(16)33-14-22(25)28)21(32-2)12-17(20)26-23(29)15-8-4-3-5-9-15/h3-13H,14H2,1-2H3,(H2,25,28)(H,26,29)(H,27,30) |
| InChIKey | OTYHEXUXSOVSPE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |