C23H21N3O5 — CID 9083669
4-[[4-(2-amino-2-oxoethoxy)benzoyl]amino]-N-(2-methoxyphenyl)benzamide (PubChem CID 9083669) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is 4-[[4-(2-amino-2-oxoethoxy)benzoyl]amino]-N-(2-methoxyphenyl)benzamide.
| Compound Name | 4-[[4-(2-amino-2-oxoethoxy)benzoyl]amino]-N-(2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 9083669 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 4-[[4-(2-amino-2-oxoethoxy)benzoyl]amino]-N-(2-methoxyphenyl)benzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)c2ccc(OCC(N)=O)cc2)cc1 |
| InChI | InChI=1S/C23H21N3O5/c1-30-20-5-3-2-4-19(20)26-23(29)15-6-10-17(11-7-15)25-22(28)16-8-12-18(13-9-16)31-14-21(24)27/h2-13H,14H2,1H3,(H2,24,27)(H,25,28)(H,26,29) |
| InChIKey | BBANGIUVGREPNV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |