C27H22N2O3 — CID 26522657
N-[4-[(2-methoxyphenyl)carbamoyl]phenyl]-4-phenylbenzamide (PubChem CID 26522657) has the molecular formula C27H22N2O3 and a molecular weight of 422.48 g/mol. Its IUPAC name is N-[4-[(2-methoxyphenyl)carbamoyl]phenyl]-4-phenylbenzamide.
| Compound Name | N-[4-[(2-methoxyphenyl)carbamoyl]phenyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 26522657 |
| Molecular Formula | C27H22N2O3 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-[4-[(2-methoxyphenyl)carbamoyl]phenyl]-4-phenylbenzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H22N2O3/c1-32-25-10-6-5-9-24(25)29-27(31)22-15-17-23(18-16-22)28-26(30)21-13-11-20(12-14-21)19-7-3-2-4-8-19/h2-18H,1H3,(H,28,30)(H,29,31) |
| InChIKey | RPVTWDPDXWQHFV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |