C23H22N2O3 — CID 9245041
N-[4-[(2-methoxyphenyl)carbamoyl]phenyl]-2,5-dimethylbenzamide (PubChem CID 9245041) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-[4-[(2-methoxyphenyl)carbamoyl]phenyl]-2,5-dimethylbenzamide.
| Compound Name | N-[4-[(2-methoxyphenyl)carbamoyl]phenyl]-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 9245041 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-[4-[(2-methoxyphenyl)carbamoyl]phenyl]-2,5-dimethylbenzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C23H22N2O3/c1-15-8-9-16(2)19(14-15)23(27)24-18-12-10-17(11-13-18)22(26)25-20-6-4-5-7-21(20)28-3/h4-14H,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | CEBAUFRXXWEPEB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |