C25H27N3O3 — CID 43001096
4-[2-(2,5-dimethylanilino)propanoylamino]-N-(2-methoxyphenyl)benzamide (PubChem CID 43001096) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-[2-(2,5-dimethylanilino)propanoylamino]-N-(2-methoxyphenyl)benzamide.
| Compound Name | 4-[2-(2,5-dimethylanilino)propanoylamino]-N-(2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 43001096 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 4-[2-(2,5-dimethylanilino)propanoylamino]-N-(2-methoxyphenyl)benzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)C(C)Nc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C25H27N3O3/c1-16-9-10-17(2)22(15-16)26-18(3)24(29)27-20-13-11-19(12-14-20)25(30)28-21-7-5-6-8-23(21)31-4/h5-15,18,26H,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | ZAOKVHCJCPVHPI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |