C17H16FN3O4 — CID 24673894
N-(5-acetamido-2-fluorophenyl)-2-(2-amino-2-oxoethoxy)benzamide (PubChem CID 24673894) has the molecular formula C17H16FN3O4 and a molecular weight of 345.33 g/mol. Its IUPAC name is N-(5-acetamido-2-fluorophenyl)-2-(2-amino-2-oxoethoxy)benzamide.
| Compound Name | N-(5-acetamido-2-fluorophenyl)-2-(2-amino-2-oxoethoxy)benzamide |
|---|---|
| PubChem CID | 24673894 |
| Molecular Formula | C17H16FN3O4 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-(5-acetamido-2-fluorophenyl)-2-(2-amino-2-oxoethoxy)benzamide |
| SMILES | CC(=O)Nc1ccc(F)c(NC(=O)c2ccccc2OCC(N)=O)c1 |
| InChI | InChI=1S/C17H16FN3O4/c1-10(22)20-11-6-7-13(18)14(8-11)21-17(24)12-4-2-3-5-15(12)25-9-16(19)23/h2-8H,9H2,1H3,(H2,19,23)(H,20,22)(H,21,24) |
| InChIKey | GBHNHWZPBQGMDV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |