C17H26N2O3 — CID 142075017
N-(4-amino-2,5-dimethoxyphenyl)benzamide;ethane;molecular hydrogen (PubChem CID 142075017) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-(4-amino-2,5-dimethoxyphenyl)benzamide;ethane;molecular hydrogen.
| Compound Name | N-(4-amino-2,5-dimethoxyphenyl)benzamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 142075017 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-(4-amino-2,5-dimethoxyphenyl)benzamide;ethane;molecular hydrogen |
| SMILES | CC.COc1cc(NC(=O)c2ccccc2)c(OC)cc1N.[H][H].[H][H] |
| InChI | InChI=1S/C15H16N2O3.C2H6.2H2/c1-19-13-9-12(14(20-2)8-11(13)16)17-15(18)10-6-4-3-5-7-10;1-2;;/h3-9H,16H2,1-2H3,(H,17,18);1-2H3;2*1H |
| InChIKey | RQUOJLSAGBKNKT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|