C21H19N3O5 — CID 42089647
N-(4-benzamido-2,5-dimethoxyphenyl)-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 42089647) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is N-(4-benzamido-2,5-dimethoxyphenyl)-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(4-benzamido-2,5-dimethoxyphenyl)-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 42089647 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-(4-benzamido-2,5-dimethoxyphenyl)-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc(=O)[nH]c2)c(OC)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H19N3O5/c1-28-17-11-16(24-21(27)14-8-9-19(25)22-12-14)18(29-2)10-15(17)23-20(26)13-6-4-3-5-7-13/h3-12H,1-2H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | DLBPEABXBTWYFO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |