C14H12N2O5 — CID 115411071
4-methoxy-2-[(6-oxo-1H-pyridine-3-carbonyl)amino]benzoic acid (PubChem CID 115411071) has the molecular formula C14H12N2O5 and a molecular weight of 288.26 g/mol. Its IUPAC name is 4-methoxy-2-[(6-oxo-1H-pyridine-3-carbonyl)amino]benzoic acid.
| Compound Name | 4-methoxy-2-[(6-oxo-1H-pyridine-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 115411071 |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 4-methoxy-2-[(6-oxo-1H-pyridine-3-carbonyl)amino]benzoic acid |
| SMILES | COc1ccc(C(=O)O)c(NC(=O)c2ccc(=O)[nH]c2)c1 |
| InChI | InChI=1S/C14H12N2O5/c1-21-9-3-4-10(14(19)20)11(6-9)16-13(18)8-2-5-12(17)15-7-8/h2-7H,1H3,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | OURVXZSKOGMOHX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |