C15H15NO6S — CID 102438408
4-benzamido-2,5-dimethoxybenzenesulfonic acid (PubChem CID 102438408) has the molecular formula C15H15NO6S and a molecular weight of 337.35 g/mol. Its IUPAC name is 4-benzamido-2,5-dimethoxybenzenesulfonic acid.
| Compound Name | 4-benzamido-2,5-dimethoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 102438408 |
| Molecular Formula | C15H15NO6S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 4-benzamido-2,5-dimethoxybenzenesulfonic acid |
| SMILES | COc1cc(S(=O)(=O)O)c(OC)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H15NO6S/c1-21-12-9-14(23(18,19)20)13(22-2)8-11(12)16-15(17)10-6-4-3-5-7-10/h3-9H,1-2H3,(H,16,17)(H,18,19,20) |
| InChIKey | ISGDVHDPGUNQPZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|