C22H20ClN3O4 — CID 19187598
N-[4-[(3-chlorophenyl)carbamoylamino]-2,5-dimethoxyphenyl]benzamide (PubChem CID 19187598) has the molecular formula C22H20ClN3O4 and a molecular weight of 425.87 g/mol. Its IUPAC name is N-[4-[(3-chlorophenyl)carbamoylamino]-2,5-dimethoxyphenyl]benzamide.
| Compound Name | N-[4-[(3-chlorophenyl)carbamoylamino]-2,5-dimethoxyphenyl]benzamide |
|---|---|
| PubChem CID | 19187598 |
| Molecular Formula | C22H20ClN3O4 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-[4-[(3-chlorophenyl)carbamoylamino]-2,5-dimethoxyphenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(OC)cc1NC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H20ClN3O4/c1-29-19-13-18(26-22(28)24-16-10-6-9-15(23)11-16)20(30-2)12-17(19)25-21(27)14-7-4-3-5-8-14/h3-13H,1-2H3,(H,25,27)(H2,24,26,28) |
| InChIKey | DDUHKKURHPYXNT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |