C24H22ClN3O5 — CID 24635188
N-[2-(4-benzamido-2,5-dimethoxyanilino)-2-oxoethyl]-3-chlorobenzamide (PubChem CID 24635188) has the molecular formula C24H22ClN3O5 and a molecular weight of 467.91 g/mol. Its IUPAC name is N-[2-(4-benzamido-2,5-dimethoxyanilino)-2-oxoethyl]-3-chlorobenzamide.
| Compound Name | N-[2-(4-benzamido-2,5-dimethoxyanilino)-2-oxoethyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 24635188 |
| Molecular Formula | C24H22ClN3O5 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | N-[2-(4-benzamido-2,5-dimethoxyanilino)-2-oxoethyl]-3-chlorobenzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(OC)cc1NC(=O)CNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H22ClN3O5/c1-32-20-13-19(28-24(31)15-7-4-3-5-8-15)21(33-2)12-18(20)27-22(29)14-26-23(30)16-9-6-10-17(25)11-16/h3-13H,14H2,1-2H3,(H,26,30)(H,27,29)(H,28,31) |
| InChIKey | UGCMDWHGHVIBSV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |