C23H19ClFN3O4 — CID 55945079
N-[5-[(2-benzamidoacetyl)amino]-2-methoxyphenyl]-4-chloro-2-fluorobenzamide (PubChem CID 55945079) has the molecular formula C23H19ClFN3O4 and a molecular weight of 455.87 g/mol. Its IUPAC name is N-[5-[(2-benzamidoacetyl)amino]-2-methoxyphenyl]-4-chloro-2-fluorobenzamide.
| Compound Name | N-[5-[(2-benzamidoacetyl)amino]-2-methoxyphenyl]-4-chloro-2-fluorobenzamide |
|---|---|
| PubChem CID | 55945079 |
| Molecular Formula | C23H19ClFN3O4 |
| Molecular Weight | 455.87 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | N-[5-[(2-benzamidoacetyl)amino]-2-methoxyphenyl]-4-chloro-2-fluorobenzamide |
| SMILES | COc1ccc(NC(=O)CNC(=O)c2ccccc2)cc1NC(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C23H19ClFN3O4/c1-32-20-10-8-16(27-21(29)13-26-22(30)14-5-3-2-4-6-14)12-19(20)28-23(31)17-9-7-15(24)11-18(17)25/h2-12H,13H2,1H3,(H,26,30)(H,27,29)(H,28,31) |
| InChIKey | GXMLQMGADJGACJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.87 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |