C22H17ClF2N2O3 — CID 52701788
N-[3-[(4-chloro-2-fluorobenzoyl)amino]-4-methoxyphenyl]-3-fluoro-4-methylbenzamide (PubChem CID 52701788) has the molecular formula C22H17ClF2N2O3 and a molecular weight of 430.84 g/mol. Its IUPAC name is N-[3-[(4-chloro-2-fluorobenzoyl)amino]-4-methoxyphenyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[3-[(4-chloro-2-fluorobenzoyl)amino]-4-methoxyphenyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 52701788 |
| Molecular Formula | C22H17ClF2N2O3 |
| Molecular Weight | 430.84 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N-[3-[(4-chloro-2-fluorobenzoyl)amino]-4-methoxyphenyl]-3-fluoro-4-methylbenzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(C)c(F)c2)cc1NC(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C22H17ClF2N2O3/c1-12-3-4-13(9-17(12)24)21(28)26-15-6-8-20(30-2)19(11-15)27-22(29)16-7-5-14(23)10-18(16)25/h3-11H,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | LYKNUDVNNOUSLK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.84 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |