C22H24ClFN2O3 — CID 55890068
4-chloro-N-[5-(3-cyclopentylpropanoylamino)-2-methoxyphenyl]-2-fluorobenzamide (PubChem CID 55890068) has the molecular formula C22H24ClFN2O3 and a molecular weight of 418.90 g/mol. Its IUPAC name is 4-chloro-N-[5-(3-cyclopentylpropanoylamino)-2-methoxyphenyl]-2-fluorobenzamide.
| Compound Name | 4-chloro-N-[5-(3-cyclopentylpropanoylamino)-2-methoxyphenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 55890068 |
| Molecular Formula | C22H24ClFN2O3 |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 4-chloro-N-[5-(3-cyclopentylpropanoylamino)-2-methoxyphenyl]-2-fluorobenzamide |
| SMILES | COc1ccc(NC(=O)CCC2CCCC2)cc1NC(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C22H24ClFN2O3/c1-29-20-10-8-16(25-21(27)11-6-14-4-2-3-5-14)13-19(20)26-22(28)17-9-7-15(23)12-18(17)24/h7-10,12-14H,2-6,11H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | RPJMIEJXPIMRPS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |