C24H23ClN2O5 — CID 19180531
N-[4-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-2,5-dimethoxyphenyl]benzamide (PubChem CID 19180531) has the molecular formula C24H23ClN2O5 and a molecular weight of 454.91 g/mol. Its IUPAC name is N-[4-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-2,5-dimethoxyphenyl]benzamide.
| Compound Name | N-[4-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-2,5-dimethoxyphenyl]benzamide |
|---|---|
| PubChem CID | 19180531 |
| Molecular Formula | C24H23ClN2O5 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-[4-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-2,5-dimethoxyphenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(OC)cc1NC(=O)COc1ccc(Cl)cc1C |
| InChI | InChI=1S/C24H23ClN2O5/c1-15-11-17(25)9-10-20(15)32-14-23(28)26-18-12-22(31-3)19(13-21(18)30-2)27-24(29)16-7-5-4-6-8-16/h4-13H,14H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | KWGCNWOGGQJOQB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |