C17H17BrClNO4 — CID 19172733
N-(4-bromo-2,5-dimethoxyphenyl)-2-(4-chloro-2-methylphenoxy)acetamide (PubChem CID 19172733) has the molecular formula C17H17BrClNO4 and a molecular weight of 414.68 g/mol. Its IUPAC name is N-(4-bromo-2,5-dimethoxyphenyl)-2-(4-chloro-2-methylphenoxy)acetamide.
| Compound Name | N-(4-bromo-2,5-dimethoxyphenyl)-2-(4-chloro-2-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 19172733 |
| Molecular Formula | C17H17BrClNO4 |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | N-(4-bromo-2,5-dimethoxyphenyl)-2-(4-chloro-2-methylphenoxy)acetamide |
| SMILES | COc1cc(NC(=O)COc2ccc(Cl)cc2C)c(OC)cc1Br |
| InChI | InChI=1S/C17H17BrClNO4/c1-10-6-11(19)4-5-14(10)24-9-17(21)20-13-8-15(22-2)12(18)7-16(13)23-3/h4-8H,9H2,1-3H3,(H,20,21) |
| InChIKey | FZKRWZSLQNXAJZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |