C15H12Br2ClNO3 — CID 5119772
2-(4-chloro-2-methylphenoxy)-N-(3,5-dibromo-4-hydroxyphenyl)acetamide (PubChem CID 5119772) has the molecular formula C15H12Br2ClNO3 and a molecular weight of 449.53 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-(3,5-dibromo-4-hydroxyphenyl)acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-(3,5-dibromo-4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 5119772 |
| Molecular Formula | C15H12Br2ClNO3 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 446.89 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-(3,5-dibromo-4-hydroxyphenyl)acetamide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)Nc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C15H12Br2ClNO3/c1-8-4-9(18)2-3-13(8)22-7-14(20)19-10-5-11(16)15(21)12(17)6-10/h2-6,21H,7H2,1H3,(H,19,20) |
| InChIKey | LILVPFASUBXJCC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|