C16H14Br2ClNO3 — CID 5119773
2-(4-chloro-3,5-dimethylphenoxy)-N-(3,5-dibromo-4-hydroxyphenyl)acetamide (PubChem CID 5119773) has the molecular formula C16H14Br2ClNO3 and a molecular weight of 463.55 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-(3,5-dibromo-4-hydroxyphenyl)acetamide.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-(3,5-dibromo-4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 5119773 |
| Molecular Formula | C16H14Br2ClNO3 |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 460.90 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-(3,5-dibromo-4-hydroxyphenyl)acetamide |
| SMILES | Cc1cc(OCC(=O)Nc2cc(Br)c(O)c(Br)c2)cc(C)c1Cl |
| InChI | InChI=1S/C16H14Br2ClNO3/c1-8-3-11(4-9(2)15(8)19)23-7-14(21)20-10-5-12(17)16(22)13(18)6-10/h3-6,22H,7H2,1-2H3,(H,20,21) |
| InChIKey | WVFSANAPUVNAPM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|