C24H24ClNO4 — CID 4958111
2-(4-chloro-3,5-dimethylphenoxy)-N-[4-(2-phenoxyethoxy)phenyl]acetamide (PubChem CID 4958111) has the molecular formula C24H24ClNO4 and a molecular weight of 425.91 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-[4-(2-phenoxyethoxy)phenyl]acetamide.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[4-(2-phenoxyethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 4958111 |
| Molecular Formula | C24H24ClNO4 |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[4-(2-phenoxyethoxy)phenyl]acetamide |
| SMILES | Cc1cc(OCC(=O)Nc2ccc(OCCOc3ccccc3)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C24H24ClNO4/c1-17-14-22(15-18(2)24(17)25)30-16-23(27)26-19-8-10-21(11-9-19)29-13-12-28-20-6-4-3-5-7-20/h3-11,14-15H,12-13,16H2,1-2H3,(H,26,27) |
| InChIKey | FYGSOBXXNZYGBB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|