C21H26N2O4 — CID 40521638
N-[4-(3,3-dimethylbutanoylamino)-2,5-dimethoxyphenyl]benzamide (PubChem CID 40521638) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[4-(3,3-dimethylbutanoylamino)-2,5-dimethoxyphenyl]benzamide.
| Compound Name | N-[4-(3,3-dimethylbutanoylamino)-2,5-dimethoxyphenyl]benzamide |
|---|---|
| PubChem CID | 40521638 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-[4-(3,3-dimethylbutanoylamino)-2,5-dimethoxyphenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(OC)cc1NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C21H26N2O4/c1-21(2,3)13-19(24)22-15-11-18(27-5)16(12-17(15)26-4)23-20(25)14-9-7-6-8-10-14/h6-12H,13H2,1-5H3,(H,22,24)(H,23,25) |
| InChIKey | XXFQLTORRCUZJZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |