C27H30N2O7 — CID 24570959
N-[2,5-dimethoxy-4-[3-(3,4,5-trimethoxyphenyl)propanoylamino]phenyl]benzamide (PubChem CID 24570959) has the molecular formula C27H30N2O7 and a molecular weight of 494.54 g/mol. Its IUPAC name is N-[2,5-dimethoxy-4-[3-(3,4,5-trimethoxyphenyl)propanoylamino]phenyl]benzamide.
| Compound Name | N-[2,5-dimethoxy-4-[3-(3,4,5-trimethoxyphenyl)propanoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 24570959 |
| Molecular Formula | C27H30N2O7 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | N-[2,5-dimethoxy-4-[3-(3,4,5-trimethoxyphenyl)propanoylamino]phenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(OC)cc1NC(=O)CCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C27H30N2O7/c1-32-21-16-20(29-27(31)18-9-7-6-8-10-18)22(33-2)15-19(21)28-25(30)12-11-17-13-23(34-3)26(36-5)24(14-17)35-4/h6-10,13-16H,11-12H2,1-5H3,(H,28,30)(H,29,31) |
| InChIKey | OYDGGNWXZAUZEJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |