C26H27FN2O6 — CID 46487241
3-fluoro-N-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)propanoylamino]phenyl]benzamide (PubChem CID 46487241) has the molecular formula C26H27FN2O6 and a molecular weight of 482.51 g/mol. Its IUPAC name is 3-fluoro-N-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)propanoylamino]phenyl]benzamide.
| Compound Name | 3-fluoro-N-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)propanoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 46487241 |
| Molecular Formula | C26H27FN2O6 |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 3-fluoro-N-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)propanoylamino]phenyl]benzamide |
| SMILES | COc1ccc(NC(=O)CCc2cc(OC)c(OC)c(OC)c2)cc1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C26H27FN2O6/c1-32-21-10-9-19(15-20(21)29-26(31)17-6-5-7-18(27)14-17)28-24(30)11-8-16-12-22(33-2)25(35-4)23(13-16)34-3/h5-7,9-10,12-15H,8,11H2,1-4H3,(H,28,30)(H,29,31) |
| InChIKey | VWPZCMRGMCMVET-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |