C19H22FN3O3 — CID 120559883
N-[5-(4-aminopentanoylamino)-2-methoxyphenyl]-3-fluorobenzamide (PubChem CID 120559883) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is N-[5-(4-aminopentanoylamino)-2-methoxyphenyl]-3-fluorobenzamide.
| Compound Name | N-[5-(4-aminopentanoylamino)-2-methoxyphenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 120559883 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[5-(4-aminopentanoylamino)-2-methoxyphenyl]-3-fluorobenzamide |
| SMILES | COc1ccc(NC(=O)CCC(C)N)cc1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C19H22FN3O3/c1-12(21)6-9-18(24)22-15-7-8-17(26-2)16(11-15)23-19(25)13-4-3-5-14(20)10-13/h3-5,7-8,10-12H,6,9,21H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | YKBZUBFYGANFKZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |