C20H20FN3O3 — CID 47065290
3-fluoro-N-[2-methoxy-5-[[1-oxo-1-(prop-2-ynylamino)propan-2-yl]amino]phenyl]benzamide (PubChem CID 47065290) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is 3-fluoro-N-[2-methoxy-5-[[1-oxo-1-(prop-2-ynylamino)propan-2-yl]amino]phenyl]benzamide.
| Compound Name | 3-fluoro-N-[2-methoxy-5-[[1-oxo-1-(prop-2-ynylamino)propan-2-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 47065290 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 3-fluoro-N-[2-methoxy-5-[[1-oxo-1-(prop-2-ynylamino)propan-2-yl]amino]phenyl]benzamide |
| SMILES | C#CCNC(=O)C(C)Nc1ccc(OC)c(NC(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C20H20FN3O3/c1-4-10-22-19(25)13(2)23-16-8-9-18(27-3)17(12-16)24-20(26)14-6-5-7-15(21)11-14/h1,5-9,11-13,23H,10H2,2-3H3,(H,22,25)(H,24,26) |
| InChIKey | JYOMUYGYOPKQKT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|