C22H20ClFN4O3 — CID 60542464
N-[5-[[1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl]amino]-2-methoxyphenyl]-3-fluorobenzamide (PubChem CID 60542464) has the molecular formula C22H20ClFN4O3 and a molecular weight of 442.88 g/mol. Its IUPAC name is N-[5-[[1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl]amino]-2-methoxyphenyl]-3-fluorobenzamide.
| Compound Name | N-[5-[[1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl]amino]-2-methoxyphenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 60542464 |
| Molecular Formula | C22H20ClFN4O3 |
| Molecular Weight | 442.88 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-[5-[[1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl]amino]-2-methoxyphenyl]-3-fluorobenzamide |
| SMILES | COc1ccc(NC(C)C(=O)Nc2ccc(Cl)cn2)cc1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C22H20ClFN4O3/c1-13(21(29)28-20-9-6-15(23)12-25-20)26-17-7-8-19(31-2)18(11-17)27-22(30)14-4-3-5-16(24)10-14/h3-13,26H,1-2H3,(H,27,30)(H,25,28,29) |
| InChIKey | QUIQZSAGKIOHSY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.88 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|