C21H20FN3O4 — CID 113036517
3-fluoro-N-[5-(3,4,5-trimethoxyanilino)-2-pyridinyl]benzamide (PubChem CID 113036517) has the molecular formula C21H20FN3O4 and a molecular weight of 397.41 g/mol. Its IUPAC name is 3-fluoro-N-[5-(3,4,5-trimethoxyanilino)-2-pyridinyl]benzamide.
| Compound Name | 3-fluoro-N-[5-(3,4,5-trimethoxyanilino)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 113036517 |
| Molecular Formula | C21H20FN3O4 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 3-fluoro-N-[5-(3,4,5-trimethoxyanilino)-2-pyridinyl]benzamide |
| SMILES | COc1cc(Nc2ccc(NC(=O)c3cccc(F)c3)nc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H20FN3O4/c1-27-17-10-16(11-18(28-2)20(17)29-3)24-15-7-8-19(23-12-15)25-21(26)13-5-4-6-14(22)9-13/h4-12,24H,1-3H3,(H,23,25,26) |
| InChIKey | GYSQBFFVKJQVMY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |