C20H18FN3O3 — CID 113034755
N-[5-(3,4-dimethoxyanilino)-2-pyridinyl]-4-fluorobenzamide (PubChem CID 113034755) has the molecular formula C20H18FN3O3 and a molecular weight of 367.38 g/mol. Its IUPAC name is N-[5-(3,4-dimethoxyanilino)-2-pyridinyl]-4-fluorobenzamide.
| Compound Name | N-[5-(3,4-dimethoxyanilino)-2-pyridinyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 113034755 |
| Molecular Formula | C20H18FN3O3 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-[5-(3,4-dimethoxyanilino)-2-pyridinyl]-4-fluorobenzamide |
| SMILES | COc1ccc(Nc2ccc(NC(=O)c3ccc(F)cc3)nc2)cc1OC |
| InChI | InChI=1S/C20H18FN3O3/c1-26-17-9-7-15(11-18(17)27-2)23-16-8-10-19(22-12-16)24-20(25)13-3-5-14(21)6-4-13/h3-12,23H,1-2H3,(H,22,24,25) |
| InChIKey | SVJQUZBXGZLLSG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |