C22H20FN3O5 — CID 1449581
N-[6-[(2-fluorobenzoyl)amino]-3-pyridinyl]-3,4,5-trimethoxybenzamide (PubChem CID 1449581) has the molecular formula C22H20FN3O5 and a molecular weight of 425.42 g/mol. Its IUPAC name is N-[6-[(2-fluorobenzoyl)amino]-3-pyridinyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[6-[(2-fluorobenzoyl)amino]-3-pyridinyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 1449581 |
| Molecular Formula | C22H20FN3O5 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-[6-[(2-fluorobenzoyl)amino]-3-pyridinyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(NC(=O)c3ccccc3F)nc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H20FN3O5/c1-29-17-10-13(11-18(30-2)20(17)31-3)21(27)25-14-8-9-19(24-12-14)26-22(28)15-6-4-5-7-16(15)23/h4-12H,1-3H3,(H,25,27)(H,24,26,28) |
| InChIKey | DQUMPUUOBKKWDK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |