C15H15ClN2O4 — CID 673854
N-(5-chloro-2-pyridinyl)-3,4,5-trimethoxybenzamide (PubChem CID 673854) has the molecular formula C15H15ClN2O4 and a molecular weight of 322.75 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 673854 |
| Molecular Formula | C15H15ClN2O4 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(Cl)cn2)cc(OC)c1OC |
| InChI | InChI=1S/C15H15ClN2O4/c1-20-11-6-9(7-12(21-2)14(11)22-3)15(19)18-13-5-4-10(16)8-17-13/h4-8H,1-3H3,(H,17,18,19) |
| InChIKey | JREKIMVYSIKXNE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |