C17H12FN3O2S — CID 1449346
N-[6-[(2-fluorobenzoyl)amino]-3-pyridinyl]thiophene-2-carboxamide (PubChem CID 1449346) has the molecular formula C17H12FN3O2S and a molecular weight of 341.37 g/mol. Its IUPAC name is N-[6-[(2-fluorobenzoyl)amino]-3-pyridinyl]thiophene-2-carboxamide.
| Compound Name | N-[6-[(2-fluorobenzoyl)amino]-3-pyridinyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 1449346 |
| Molecular Formula | C17H12FN3O2S |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | N-[6-[(2-fluorobenzoyl)amino]-3-pyridinyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2ccccc2F)nc1)c1cccs1 |
| InChI | InChI=1S/C17H12FN3O2S/c18-13-5-2-1-4-12(13)16(22)21-15-8-7-11(10-19-15)20-17(23)14-6-3-9-24-14/h1-10H,(H,20,23)(H,19,21,22) |
| InChIKey | CHOUNUWLKHIUNO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |