C22H25FN4O3 — CID 60542237
N-[5-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethylamino]-2-methoxyphenyl]-3-fluorobenzamide (PubChem CID 60542237) has the molecular formula C22H25FN4O3 and a molecular weight of 412.47 g/mol. Its IUPAC name is N-[5-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethylamino]-2-methoxyphenyl]-3-fluorobenzamide.
| Compound Name | N-[5-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethylamino]-2-methoxyphenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 60542237 |
| Molecular Formula | C22H25FN4O3 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-[5-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethylamino]-2-methoxyphenyl]-3-fluorobenzamide |
| SMILES | CCCCc1noc(C(C)Nc2ccc(OC)c(NC(=O)c3cccc(F)c3)c2)n1 |
| InChI | InChI=1S/C22H25FN4O3/c1-4-5-9-20-26-22(30-27-20)14(2)24-17-10-11-19(29-3)18(13-17)25-21(28)15-7-6-8-16(23)12-15/h6-8,10-14,24H,4-5,9H2,1-3H3,(H,25,28) |
| InChIKey | ZDDJHALYMSZQRC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|