C16H17ClN4O3 — CID 87033176
methyl N-[4-[[1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl]amino]phenyl]carbamate (PubChem CID 87033176) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is methyl N-[4-[[1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl]amino]phenyl]carbamate.
| Compound Name | methyl N-[4-[[1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 87033176 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | methyl N-[4-[[1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl]amino]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(NC(C)C(=O)Nc2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C16H17ClN4O3/c1-10(15(22)21-14-8-3-11(17)9-18-14)19-12-4-6-13(7-5-12)20-16(23)24-2/h3-10,19H,1-2H3,(H,20,23)(H,18,21,22) |
| InChIKey | JHHRCEGFPVGZGP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |