C19H24N4O3 — CID 94643027
methyl N-[4-[[(2R)-1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl]amino]phenyl]carbamate (PubChem CID 94643027) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is methyl N-[4-[[(2R)-1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl]amino]phenyl]carbamate.
| Compound Name | methyl N-[4-[[(2R)-1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 94643027 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | methyl N-[4-[[(2R)-1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl]amino]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(N[C@H](C)C(=O)Nc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H24N4O3/c1-13(18(24)21-15-9-11-17(12-10-15)23(2)3)20-14-5-7-16(8-6-14)22-19(25)26-4/h5-13,20H,1-4H3,(H,21,24)(H,22,25)/t13-/m1/s1 |
| InChIKey | ZHJZLKSLJURBBB-CYBMUJFWSA-N |
| XLogP | 3.37 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|